C20H26FN3O5S2 — CID 55910283
5-(ethylsulfamoyl)-2-fluoro-N-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]benzamide (PubChem CID 55910283) has the molecular formula C20H26FN3O5S2 and a molecular weight of 471.58 g/mol. Its IUPAC name is 5-(ethylsulfamoyl)-2-fluoro-N-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]benzamide.
| Compound Name | 5-(ethylsulfamoyl)-2-fluoro-N-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 55910283 |
| Molecular Formula | C20H26FN3O5S2 |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 5-(ethylsulfamoyl)-2-fluoro-N-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]benzamide |
| SMILES | CCNS(=O)(=O)c1ccc(F)c(C(=O)NCc2ccc(CS(=O)(=O)NC(C)C)cc2)c1 |
| InChI | InChI=1S/C20H26FN3O5S2/c1-4-23-31(28,29)17-9-10-19(21)18(11-17)20(25)22-12-15-5-7-16(8-6-15)13-30(26,27)24-14(2)3/h5-11,14,23-24H,4,12-13H2,1-3H3,(H,22,25) |
| InChIKey | BXMINXSMAOOZSU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |