C15H22FN3O4S — CID 48532285
N-[2-(diethylamino)-2-oxoethyl]-5-(ethylsulfamoyl)-2-fluorobenzamide (PubChem CID 48532285) has the molecular formula C15H22FN3O4S and a molecular weight of 359.42 g/mol. Its IUPAC name is N-[2-(diethylamino)-2-oxoethyl]-5-(ethylsulfamoyl)-2-fluorobenzamide.
| Compound Name | N-[2-(diethylamino)-2-oxoethyl]-5-(ethylsulfamoyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 48532285 |
| Molecular Formula | C15H22FN3O4S |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | N-[2-(diethylamino)-2-oxoethyl]-5-(ethylsulfamoyl)-2-fluorobenzamide |
| SMILES | CCNS(=O)(=O)c1ccc(F)c(C(=O)NCC(=O)N(CC)CC)c1 |
| InChI | InChI=1S/C15H22FN3O4S/c1-4-18-24(22,23)11-7-8-13(16)12(9-11)15(21)17-10-14(20)19(5-2)6-3/h7-9,18H,4-6,10H2,1-3H3,(H,17,21) |
| InChIKey | XYFXYVZLMZXMCT-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |