C18H25FN2O5S — CID 55969219
ethyl 1-[[5-(ethylsulfamoyl)-2-fluorobenzoyl]amino]cyclohexane-1-carboxylate (PubChem CID 55969219) has the molecular formula C18H25FN2O5S and a molecular weight of 400.47 g/mol. Its IUPAC name is ethyl 1-[[5-(ethylsulfamoyl)-2-fluorobenzoyl]amino]cyclohexane-1-carboxylate.
| Compound Name | ethyl 1-[[5-(ethylsulfamoyl)-2-fluorobenzoyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 55969219 |
| Molecular Formula | C18H25FN2O5S |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | ethyl 1-[[5-(ethylsulfamoyl)-2-fluorobenzoyl]amino]cyclohexane-1-carboxylate |
| SMILES | CCNS(=O)(=O)c1ccc(F)c(C(=O)NC2(C(=O)OCC)CCCCC2)c1 |
| InChI | InChI=1S/C18H25FN2O5S/c1-3-20-27(24,25)13-8-9-15(19)14(12-13)16(22)21-18(17(23)26-4-2)10-6-5-7-11-18/h8-9,12,20H,3-7,10-11H2,1-2H3,(H,21,22) |
| InChIKey | XAEARFVXZSRKET-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |