C21H32N2O6S — CID 55768220
ethyl 1-[[3-(tert-butylsulfamoyl)-4-methoxybenzoyl]amino]cyclohexane-1-carboxylate (PubChem CID 55768220) has the molecular formula C21H32N2O6S and a molecular weight of 440.56 g/mol. Its IUPAC name is ethyl 1-[[3-(tert-butylsulfamoyl)-4-methoxybenzoyl]amino]cyclohexane-1-carboxylate.
| Compound Name | ethyl 1-[[3-(tert-butylsulfamoyl)-4-methoxybenzoyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 55768220 |
| Molecular Formula | C21H32N2O6S |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | ethyl 1-[[3-(tert-butylsulfamoyl)-4-methoxybenzoyl]amino]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1(NC(=O)c2ccc(OC)c(S(=O)(=O)NC(C)(C)C)c2)CCCCC1 |
| InChI | InChI=1S/C21H32N2O6S/c1-6-29-19(25)21(12-8-7-9-13-21)22-18(24)15-10-11-16(28-5)17(14-15)30(26,27)23-20(2,3)4/h10-11,14,23H,6-9,12-13H2,1-5H3,(H,22,24) |
| InChIKey | JKQSSWSVUMXGIZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |