C18H30N2O4S — CID 51166061
N-butyl-3-(tert-butylsulfamoyl)-N-ethyl-4-methoxybenzamide (PubChem CID 51166061) has the molecular formula C18H30N2O4S and a molecular weight of 370.52 g/mol. Its IUPAC name is N-butyl-3-(tert-butylsulfamoyl)-N-ethyl-4-methoxybenzamide.
| Compound Name | N-butyl-3-(tert-butylsulfamoyl)-N-ethyl-4-methoxybenzamide |
|---|---|
| PubChem CID | 51166061 |
| Molecular Formula | C18H30N2O4S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | N-butyl-3-(tert-butylsulfamoyl)-N-ethyl-4-methoxybenzamide |
| SMILES | CCCCN(CC)C(=O)c1ccc(OC)c(S(=O)(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C18H30N2O4S/c1-7-9-12-20(8-2)17(21)14-10-11-15(24-6)16(13-14)25(22,23)19-18(3,4)5/h10-11,13,19H,7-9,12H2,1-6H3 |
| InChIKey | SEDJUQREQVCSHV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |