C24H35N3O4S — CID 31610027
3-(tert-butylsulfamoyl)-N-[[4-(diethylaminomethyl)phenyl]methyl]-4-methoxybenzamide (PubChem CID 31610027) has the molecular formula C24H35N3O4S and a molecular weight of 461.63 g/mol. Its IUPAC name is 3-(tert-butylsulfamoyl)-N-[[4-(diethylaminomethyl)phenyl]methyl]-4-methoxybenzamide.
| Compound Name | 3-(tert-butylsulfamoyl)-N-[[4-(diethylaminomethyl)phenyl]methyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 31610027 |
| Molecular Formula | C24H35N3O4S |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 3-(tert-butylsulfamoyl)-N-[[4-(diethylaminomethyl)phenyl]methyl]-4-methoxybenzamide |
| SMILES | CCN(CC)Cc1ccc(CNC(=O)c2ccc(OC)c(S(=O)(=O)NC(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C24H35N3O4S/c1-7-27(8-2)17-19-11-9-18(10-12-19)16-25-23(28)20-13-14-21(31-6)22(15-20)32(29,30)26-24(3,4)5/h9-15,26H,7-8,16-17H2,1-6H3,(H,25,28) |
| InChIKey | RQTUAUXNISMGPC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |