C19H25N3O5S — CID 37485901
3-(tert-butylsulfamoyl)-4-methoxy-N-[(2-methoxy-3-pyridinyl)methyl]benzamide (PubChem CID 37485901) has the molecular formula C19H25N3O5S and a molecular weight of 407.49 g/mol. Its IUPAC name is 3-(tert-butylsulfamoyl)-4-methoxy-N-[(2-methoxy-3-pyridinyl)methyl]benzamide.
| Compound Name | 3-(tert-butylsulfamoyl)-4-methoxy-N-[(2-methoxy-3-pyridinyl)methyl]benzamide |
|---|---|
| PubChem CID | 37485901 |
| Molecular Formula | C19H25N3O5S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 3-(tert-butylsulfamoyl)-4-methoxy-N-[(2-methoxy-3-pyridinyl)methyl]benzamide |
| SMILES | COc1ccc(C(=O)NCc2cccnc2OC)cc1S(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C19H25N3O5S/c1-19(2,3)22-28(24,25)16-11-13(8-9-15(16)26-4)17(23)21-12-14-7-6-10-20-18(14)27-5/h6-11,22H,12H2,1-5H3,(H,21,23) |
| InChIKey | GSDYSYFPOZGECN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |