C17H23FN4O3S2 — CID 89269365
1-[[5-(ethylsulfamoyl)-2-fluorobenzoyl]amino]ethenyl (Z)-N-aminocyclopentanecarboximidothioate (PubChem CID 89269365) has the molecular formula C17H23FN4O3S2 and a molecular weight of 414.53 g/mol. Its IUPAC name is 1-[[5-(ethylsulfamoyl)-2-fluorobenzoyl]amino]ethenyl (Z)-N-aminocyclopentanecarboximidothioate.
| Compound Name | 1-[[5-(ethylsulfamoyl)-2-fluorobenzoyl]amino]ethenyl (Z)-N-aminocyclopentanecarboximidothioate |
|---|---|
| PubChem CID | 89269365 |
| Molecular Formula | C17H23FN4O3S2 |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 1-[[5-(ethylsulfamoyl)-2-fluorobenzoyl]amino]ethenyl (Z)-N-aminocyclopentanecarboximidothioate |
| SMILES | C=C(NC(=O)c1cc(S(=O)(=O)NCC)ccc1F)S/C(=N\N)C1CCCC1 |
| InChI | InChI=1S/C17H23FN4O3S2/c1-3-20-27(24,25)13-8-9-15(18)14(10-13)16(23)21-11(2)26-17(22-19)12-6-4-5-7-12/h8-10,12,20H,2-7,19H2,1H3,(H,21,23)/b22-17- |
| InChIKey | UPNPHFROSWNVQE-XLNRJJMWSA-N |
| XLogP | 2.52 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|