C23H23N5O — CID 78873007
1-benzyl-5-ethyl-N-[(1-phenylpyrazol-4-yl)methyl]pyrazole-4-carboxamide (PubChem CID 78873007) has the molecular formula C23H23N5O and a molecular weight of 385.47 g/mol. Its IUPAC name is 1-benzyl-5-ethyl-N-[(1-phenylpyrazol-4-yl)methyl]pyrazole-4-carboxamide.
| Compound Name | 1-benzyl-5-ethyl-N-[(1-phenylpyrazol-4-yl)methyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 78873007 |
| Molecular Formula | C23H23N5O |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 1-benzyl-5-ethyl-N-[(1-phenylpyrazol-4-yl)methyl]pyrazole-4-carboxamide |
| SMILES | CCc1c(C(=O)NCc2cnn(-c3ccccc3)c2)cnn1Cc1ccccc1 |
| InChI | InChI=1S/C23H23N5O/c1-2-22-21(15-26-28(22)16-18-9-5-3-6-10-18)23(29)24-13-19-14-25-27(17-19)20-11-7-4-8-12-20/h3-12,14-15,17H,2,13,16H2,1H3,(H,24,29) |
| InChIKey | DPBSXVMVVHYYNR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |