C16H22N4O2S — CID 16616688
N-[(1-phenylpyrazol-4-yl)methyl]azepane-1-sulfonamide (PubChem CID 16616688) has the molecular formula C16H22N4O2S and a molecular weight of 334.44 g/mol. Its IUPAC name is N-[(1-phenylpyrazol-4-yl)methyl]azepane-1-sulfonamide.
| Compound Name | N-[(1-phenylpyrazol-4-yl)methyl]azepane-1-sulfonamide |
|---|---|
| PubChem CID | 16616688 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | N-[(1-phenylpyrazol-4-yl)methyl]azepane-1-sulfonamide |
| SMILES | O=S(=O)(NCc1cnn(-c2ccccc2)c1)N1CCCCCC1 |
| InChI | InChI=1S/C16H22N4O2S/c21-23(22,19-10-6-1-2-7-11-19)18-13-15-12-17-20(14-15)16-8-4-3-5-9-16/h3-5,8-9,12,14,18H,1-2,6-7,10-11,13H2 |
| InChIKey | RHIFKXNZEVPIHC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |