C15H15N3O2S2 — CID 31111062
5-methyl-N-[(1-phenylpyrazol-4-yl)methyl]thiophene-2-sulfonamide (PubChem CID 31111062) has the molecular formula C15H15N3O2S2 and a molecular weight of 333.44 g/mol. Its IUPAC name is 5-methyl-N-[(1-phenylpyrazol-4-yl)methyl]thiophene-2-sulfonamide.
| Compound Name | 5-methyl-N-[(1-phenylpyrazol-4-yl)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 31111062 |
| Molecular Formula | C15H15N3O2S2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 5-methyl-N-[(1-phenylpyrazol-4-yl)methyl]thiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCc2cnn(-c3ccccc3)c2)s1 |
| InChI | InChI=1S/C15H15N3O2S2/c1-12-7-8-15(21-12)22(19,20)17-10-13-9-16-18(11-13)14-5-3-2-4-6-14/h2-9,11,17H,10H2,1H3 |
| InChIKey | LRGWZUSYFZFUMP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |