C22H27N3O2S — CID 18269364
2,3,4,5,6-pentamethyl-N-[2-(1-phenylpyrazol-4-yl)ethyl]benzenesulfonamide (PubChem CID 18269364) has the molecular formula C22H27N3O2S and a molecular weight of 397.54 g/mol. Its IUPAC name is 2,3,4,5,6-pentamethyl-N-[2-(1-phenylpyrazol-4-yl)ethyl]benzenesulfonamide.
| Compound Name | 2,3,4,5,6-pentamethyl-N-[2-(1-phenylpyrazol-4-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 18269364 |
| Molecular Formula | C22H27N3O2S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 2,3,4,5,6-pentamethyl-N-[2-(1-phenylpyrazol-4-yl)ethyl]benzenesulfonamide |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)NCCc2cnn(-c3ccccc3)c2)c(C)c1C |
| InChI | InChI=1S/C22H27N3O2S/c1-15-16(2)18(4)22(19(5)17(15)3)28(26,27)24-12-11-20-13-23-25(14-20)21-9-7-6-8-10-21/h6-10,13-14,24H,11-12H2,1-5H3 |
| InChIKey | GXDMMHJRVVIUJS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |