C21H34N4O2S — CID 55989026
4-[2-[bis(3-methylbutyl)sulfamoylamino]ethyl]-1-phenylpyrazole (PubChem CID 55989026) has the molecular formula C21H34N4O2S and a molecular weight of 406.60 g/mol. Its IUPAC name is 4-[2-[bis(3-methylbutyl)sulfamoylamino]ethyl]-1-phenylpyrazole.
| Compound Name | 4-[2-[bis(3-methylbutyl)sulfamoylamino]ethyl]-1-phenylpyrazole |
|---|---|
| PubChem CID | 55989026 |
| Molecular Formula | C21H34N4O2S |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 4-[2-[bis(3-methylbutyl)sulfamoylamino]ethyl]-1-phenylpyrazole |
| SMILES | CC(C)CCN(CCC(C)C)S(=O)(=O)NCCc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C21H34N4O2S/c1-18(2)11-14-24(15-12-19(3)4)28(26,27)23-13-10-20-16-22-25(17-20)21-8-6-5-7-9-21/h5-9,16-19,23H,10-15H2,1-4H3 |
| InChIKey | ILDIKOLVCKXCLN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |