C9H10ClN3O2S2 — CID 22209337
5-chloro-N-[(1-methylpyrazol-4-yl)methyl]thiophene-2-sulfonamide (PubChem CID 22209337) has the molecular formula C9H10ClN3O2S2 and a molecular weight of 291.79 g/mol. Its IUPAC name is 5-chloro-N-[(1-methylpyrazol-4-yl)methyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[(1-methylpyrazol-4-yl)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 22209337 |
| Molecular Formula | C9H10ClN3O2S2 |
| Molecular Weight | 291.79 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | 5-chloro-N-[(1-methylpyrazol-4-yl)methyl]thiophene-2-sulfonamide |
| SMILES | Cn1cc(CNS(=O)(=O)c2ccc(Cl)s2)cn1 |
| InChI | InChI=1S/C9H10ClN3O2S2/c1-13-6-7(4-11-13)5-12-17(14,15)9-3-2-8(10)16-9/h2-4,6,12H,5H2,1H3 |
| InChIKey | MTFHULPAZVCFHE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.79 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |