C13H20N4O2S2 — CID 106018225
N-[(1-methylpyrazol-4-yl)methyl]-5-[(propan-2-ylamino)methyl]thiophene-2-sulfonamide (PubChem CID 106018225) has the molecular formula C13H20N4O2S2 and a molecular weight of 328.46 g/mol. Its IUPAC name is N-[(1-methylpyrazol-4-yl)methyl]-5-[(propan-2-ylamino)methyl]thiophene-2-sulfonamide.
| Compound Name | N-[(1-methylpyrazol-4-yl)methyl]-5-[(propan-2-ylamino)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106018225 |
| Molecular Formula | C13H20N4O2S2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | N-[(1-methylpyrazol-4-yl)methyl]-5-[(propan-2-ylamino)methyl]thiophene-2-sulfonamide |
| SMILES | CC(C)NCc1ccc(S(=O)(=O)NCc2cnn(C)c2)s1 |
| InChI | InChI=1S/C13H20N4O2S2/c1-10(2)14-8-12-4-5-13(20-12)21(18,19)16-7-11-6-15-17(3)9-11/h4-6,9-10,14,16H,7-8H2,1-3H3 |
| InChIKey | JZRYQPNHINOBFW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |