C10H16N6O2S2 — CID 106051525
5-[(propan-2-ylamino)methyl]-N-(2H-tetrazol-5-ylmethyl)thiophene-2-sulfonamide (PubChem CID 106051525) has the molecular formula C10H16N6O2S2 and a molecular weight of 316.41 g/mol. Its IUPAC name is 5-[(propan-2-ylamino)methyl]-N-(2H-tetrazol-5-ylmethyl)thiophene-2-sulfonamide.
| Compound Name | 5-[(propan-2-ylamino)methyl]-N-(2H-tetrazol-5-ylmethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106051525 |
| Molecular Formula | C10H16N6O2S2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 5-[(propan-2-ylamino)methyl]-N-(2H-tetrazol-5-ylmethyl)thiophene-2-sulfonamide |
| SMILES | CC(C)NCc1ccc(S(=O)(=O)NCc2nn[nH]n2)s1 |
| InChI | InChI=1S/C10H16N6O2S2/c1-7(2)11-5-8-3-4-10(19-8)20(17,18)12-6-9-13-15-16-14-9/h3-4,7,11-12H,5-6H2,1-2H3,(H,13,14,15,16) |
| InChIKey | GCOHAULBFYKETL-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |