C9H11ClN4O2S2 — CID 79524048
N-[(5-amino-1-methylpyrazol-4-yl)methyl]-5-chlorothiophene-2-sulfonamide (PubChem CID 79524048) has the molecular formula C9H11ClN4O2S2 and a molecular weight of 306.80 g/mol. Its IUPAC name is N-[(5-amino-1-methylpyrazol-4-yl)methyl]-5-chlorothiophene-2-sulfonamide.
| Compound Name | N-[(5-amino-1-methylpyrazol-4-yl)methyl]-5-chlorothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 79524048 |
| Molecular Formula | C9H11ClN4O2S2 |
| Molecular Weight | 306.80 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | N-[(5-amino-1-methylpyrazol-4-yl)methyl]-5-chlorothiophene-2-sulfonamide |
| SMILES | Cn1ncc(CNS(=O)(=O)c2ccc(Cl)s2)c1N |
| InChI | InChI=1S/C9H11ClN4O2S2/c1-14-9(11)6(4-12-14)5-13-18(15,16)8-3-2-7(10)17-8/h2-4,13H,5,11H2,1H3 |
| InChIKey | CJHCTVKRCZUKIH-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.80 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |