C11H14N4O4S2 — CID 79529174
methyl 3-[(5-amino-1-methylpyrazol-4-yl)methylsulfamoyl]thiophene-2-carboxylate (PubChem CID 79529174) has the molecular formula C11H14N4O4S2 and a molecular weight of 330.39 g/mol. Its IUPAC name is methyl 3-[(5-amino-1-methylpyrazol-4-yl)methylsulfamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 3-[(5-amino-1-methylpyrazol-4-yl)methylsulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 79529174 |
| Molecular Formula | C11H14N4O4S2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | methyl 3-[(5-amino-1-methylpyrazol-4-yl)methylsulfamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1S(=O)(=O)NCc1cnn(C)c1N |
| InChI | InChI=1S/C11H14N4O4S2/c1-15-10(12)7(5-13-15)6-14-21(17,18)8-3-4-20-9(8)11(16)19-2/h3-5,14H,6,12H2,1-2H3 |
| InChIKey | IIEXTBJQMPRTOB-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |