C14H12F3NO5S2 — CID 3750756
methyl 3-[[2-(trifluoromethoxy)phenyl]methylsulfamoyl]thiophene-2-carboxylate (PubChem CID 3750756) has the molecular formula C14H12F3NO5S2 and a molecular weight of 395.38 g/mol. Its IUPAC name is methyl 3-[[2-(trifluoromethoxy)phenyl]methylsulfamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[2-(trifluoromethoxy)phenyl]methylsulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 3750756 |
| Molecular Formula | C14H12F3NO5S2 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.01 |
| IUPAC Name | methyl 3-[[2-(trifluoromethoxy)phenyl]methylsulfamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1S(=O)(=O)NCc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C14H12F3NO5S2/c1-22-13(19)12-11(6-7-24-12)25(20,21)18-8-9-4-2-3-5-10(9)23-14(15,16)17/h2-7,18H,8H2,1H3 |
| InChIKey | IQOALGOAXYZJAI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |