C16H13F2NO5S2 — CID 90577959
methyl 3-[4-(2,4-difluorophenoxy)but-2-ynylsulfamoyl]thiophene-2-carboxylate (PubChem CID 90577959) has the molecular formula C16H13F2NO5S2 and a molecular weight of 401.41 g/mol. Its IUPAC name is methyl 3-[4-(2,4-difluorophenoxy)but-2-ynylsulfamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 3-[4-(2,4-difluorophenoxy)but-2-ynylsulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 90577959 |
| Molecular Formula | C16H13F2NO5S2 |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | methyl 3-[4-(2,4-difluorophenoxy)but-2-ynylsulfamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1S(=O)(=O)NCC#CCOc1ccc(F)cc1F |
| InChI | InChI=1S/C16H13F2NO5S2/c1-23-16(20)15-14(6-9-25-15)26(21,22)19-7-2-3-8-24-13-5-4-11(17)10-12(13)18/h4-6,9-10,19H,7-8H2,1H3 |
| InChIKey | CVBHEEAXYGXGOJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|