C15H12FNO4S2 — CID 90552674
methyl 3-[3-(2-fluorophenyl)prop-2-ynylsulfamoyl]thiophene-2-carboxylate (PubChem CID 90552674) has the molecular formula C15H12FNO4S2 and a molecular weight of 353.40 g/mol. Its IUPAC name is methyl 3-[3-(2-fluorophenyl)prop-2-ynylsulfamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 3-[3-(2-fluorophenyl)prop-2-ynylsulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 90552674 |
| Molecular Formula | C15H12FNO4S2 |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | methyl 3-[3-(2-fluorophenyl)prop-2-ynylsulfamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1S(=O)(=O)NCC#Cc1ccccc1F |
| InChI | InChI=1S/C15H12FNO4S2/c1-21-15(18)14-13(8-10-22-14)23(19,20)17-9-4-6-11-5-2-3-7-12(11)16/h2-3,5,7-8,10,17H,9H2,1H3 |
| InChIKey | PSBIZLJXLMTMHP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|