C19H19NO5S2 — CID 90577142
methyl 3-[4-(2-prop-2-enylphenoxy)but-2-ynylsulfamoyl]thiophene-2-carboxylate (PubChem CID 90577142) has the molecular formula C19H19NO5S2 and a molecular weight of 405.50 g/mol. Its IUPAC name is methyl 3-[4-(2-prop-2-enylphenoxy)but-2-ynylsulfamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 3-[4-(2-prop-2-enylphenoxy)but-2-ynylsulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 90577142 |
| Molecular Formula | C19H19NO5S2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | methyl 3-[4-(2-prop-2-enylphenoxy)but-2-ynylsulfamoyl]thiophene-2-carboxylate |
| SMILES | C=CCc1ccccc1OCC#CCNS(=O)(=O)c1ccsc1C(=O)OC |
| InChI | InChI=1S/C19H19NO5S2/c1-3-8-15-9-4-5-10-16(15)25-13-7-6-12-20-27(22,23)17-11-14-26-18(17)19(21)24-2/h3-5,9-11,14,20H,1,8,12-13H2,2H3 |
| InChIKey | OHRABLWSCLEUHG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|