C17H15NO5S2 — CID 90553380
methyl 3-[3-(4-acetylphenyl)prop-2-ynylsulfamoyl]thiophene-2-carboxylate (PubChem CID 90553380) has the molecular formula C17H15NO5S2 and a molecular weight of 377.44 g/mol. Its IUPAC name is methyl 3-[3-(4-acetylphenyl)prop-2-ynylsulfamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 3-[3-(4-acetylphenyl)prop-2-ynylsulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 90553380 |
| Molecular Formula | C17H15NO5S2 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | methyl 3-[3-(4-acetylphenyl)prop-2-ynylsulfamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1S(=O)(=O)NCC#Cc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C17H15NO5S2/c1-12(19)14-7-5-13(6-8-14)4-3-10-18-25(21,22)15-9-11-24-16(15)17(20)23-2/h5-9,11,18H,10H2,1-2H3 |
| InChIKey | JFUXTMAZUGIGAY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|