C17H14F2N2O4S — CID 90580636
2-[4-[(2,4-difluorophenyl)sulfonylamino]but-2-ynoxy]benzamide (PubChem CID 90580636) has the molecular formula C17H14F2N2O4S and a molecular weight of 380.37 g/mol. Its IUPAC name is 2-[4-[(2,4-difluorophenyl)sulfonylamino]but-2-ynoxy]benzamide.
| Compound Name | 2-[4-[(2,4-difluorophenyl)sulfonylamino]but-2-ynoxy]benzamide |
|---|---|
| PubChem CID | 90580636 |
| Molecular Formula | C17H14F2N2O4S |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 2-[4-[(2,4-difluorophenyl)sulfonylamino]but-2-ynoxy]benzamide |
| SMILES | NC(=O)c1ccccc1OCC#CCNS(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H14F2N2O4S/c18-12-7-8-16(14(19)11-12)26(23,24)21-9-3-4-10-25-15-6-2-1-5-13(15)17(20)22/h1-2,5-8,11,21H,9-10H2,(H2,20,22) |
| InChIKey | NDVJFJBIBXAHSL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|