C17H16FNO4S — CID 71802972
2-fluoro-N-[4-(2-methoxyphenoxy)but-2-ynyl]benzenesulfonamide (PubChem CID 71802972) has the molecular formula C17H16FNO4S and a molecular weight of 349.38 g/mol. Its IUPAC name is 2-fluoro-N-[4-(2-methoxyphenoxy)but-2-ynyl]benzenesulfonamide.
| Compound Name | 2-fluoro-N-[4-(2-methoxyphenoxy)but-2-ynyl]benzenesulfonamide |
|---|---|
| PubChem CID | 71802972 |
| Molecular Formula | C17H16FNO4S |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 2-fluoro-N-[4-(2-methoxyphenoxy)but-2-ynyl]benzenesulfonamide |
| SMILES | COc1ccccc1OCC#CCNS(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C17H16FNO4S/c1-22-15-9-3-4-10-16(15)23-13-7-6-12-19-24(20,21)17-11-5-2-8-14(17)18/h2-5,8-11,19H,12-13H2,1H3 |
| InChIKey | FHOYAVKUHOZWEC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|