C18H18ClNO4S — CID 90575738
5-chloro-N-[4-(2-methoxyphenoxy)but-2-ynyl]-2-methylbenzenesulfonamide (PubChem CID 90575738) has the molecular formula C18H18ClNO4S and a molecular weight of 379.87 g/mol. Its IUPAC name is 5-chloro-N-[4-(2-methoxyphenoxy)but-2-ynyl]-2-methylbenzenesulfonamide.
| Compound Name | 5-chloro-N-[4-(2-methoxyphenoxy)but-2-ynyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 90575738 |
| Molecular Formula | C18H18ClNO4S |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 5-chloro-N-[4-(2-methoxyphenoxy)but-2-ynyl]-2-methylbenzenesulfonamide |
| SMILES | COc1ccccc1OCC#CCNS(=O)(=O)c1cc(Cl)ccc1C |
| InChI | InChI=1S/C18H18ClNO4S/c1-14-9-10-15(19)13-18(14)25(21,22)20-11-5-6-12-24-17-8-4-3-7-16(17)23-2/h3-4,7-10,13,20H,11-12H2,1-2H3 |
| InChIKey | TXWVCAIHXFCLRJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|