C21H18FNO4S — CID 90578313
5-fluoro-2-methoxy-N-(4-naphthalen-1-yloxybut-2-ynyl)benzenesulfonamide (PubChem CID 90578313) has the molecular formula C21H18FNO4S and a molecular weight of 399.44 g/mol. Its IUPAC name is 5-fluoro-2-methoxy-N-(4-naphthalen-1-yloxybut-2-ynyl)benzenesulfonamide.
| Compound Name | 5-fluoro-2-methoxy-N-(4-naphthalen-1-yloxybut-2-ynyl)benzenesulfonamide |
|---|---|
| PubChem CID | 90578313 |
| Molecular Formula | C21H18FNO4S |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 5-fluoro-2-methoxy-N-(4-naphthalen-1-yloxybut-2-ynyl)benzenesulfonamide |
| SMILES | COc1ccc(F)cc1S(=O)(=O)NCC#CCOc1cccc2ccccc12 |
| InChI | InChI=1S/C21H18FNO4S/c1-26-20-12-11-17(22)15-21(20)28(24,25)23-13-4-5-14-27-19-10-6-8-16-7-2-3-9-18(16)19/h2-3,6-12,15,23H,13-14H2,1H3 |
| InChIKey | OGKOXHRVDHOIRR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|