C21H18FNO3S — CID 90578344
1-(4-fluorophenyl)-N-(4-naphthalen-1-yloxybut-2-ynyl)methanesulfonamide (PubChem CID 90578344) has the molecular formula C21H18FNO3S and a molecular weight of 383.44 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-(4-naphthalen-1-yloxybut-2-ynyl)methanesulfonamide.
| Compound Name | 1-(4-fluorophenyl)-N-(4-naphthalen-1-yloxybut-2-ynyl)methanesulfonamide |
|---|---|
| PubChem CID | 90578344 |
| Molecular Formula | C21H18FNO3S |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 1-(4-fluorophenyl)-N-(4-naphthalen-1-yloxybut-2-ynyl)methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccc(F)cc1)NCC#CCOc1cccc2ccccc12 |
| InChI | InChI=1S/C21H18FNO3S/c22-19-12-10-17(11-13-19)16-27(24,25)23-14-3-4-15-26-21-9-5-7-18-6-1-2-8-20(18)21/h1-2,5-13,23H,14-16H2 |
| InChIKey | ZSRHJNLDCJVJAW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|