C19H18N2O4S — CID 90578310
3,5-dimethyl-N-(4-naphthalen-1-yloxybut-2-ynyl)-1,2-oxazole-4-sulfonamide (PubChem CID 90578310) has the molecular formula C19H18N2O4S and a molecular weight of 370.43 g/mol. Its IUPAC name is 3,5-dimethyl-N-(4-naphthalen-1-yloxybut-2-ynyl)-1,2-oxazole-4-sulfonamide.
| Compound Name | 3,5-dimethyl-N-(4-naphthalen-1-yloxybut-2-ynyl)-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 90578310 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 3,5-dimethyl-N-(4-naphthalen-1-yloxybut-2-ynyl)-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)NCC#CCOc1cccc2ccccc12 |
| InChI | InChI=1S/C19H18N2O4S/c1-14-19(15(2)25-21-14)26(22,23)20-12-5-6-13-24-18-11-7-9-16-8-3-4-10-17(16)18/h3-4,7-11,20H,12-13H2,1-2H3 |
| InChIKey | QRBUGJRVUCRDQL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|