C22H21NO3S — CID 90578345
1-(3-methylphenyl)-N-(4-naphthalen-1-yloxybut-2-ynyl)methanesulfonamide (PubChem CID 90578345) has the molecular formula C22H21NO3S and a molecular weight of 379.48 g/mol. Its IUPAC name is 1-(3-methylphenyl)-N-(4-naphthalen-1-yloxybut-2-ynyl)methanesulfonamide.
| Compound Name | 1-(3-methylphenyl)-N-(4-naphthalen-1-yloxybut-2-ynyl)methanesulfonamide |
|---|---|
| PubChem CID | 90578345 |
| Molecular Formula | C22H21NO3S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 1-(3-methylphenyl)-N-(4-naphthalen-1-yloxybut-2-ynyl)methanesulfonamide |
| SMILES | Cc1cccc(CS(=O)(=O)NCC#CCOc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C22H21NO3S/c1-18-8-6-9-19(16-18)17-27(24,25)23-14-4-5-15-26-22-13-7-11-20-10-2-3-12-21(20)22/h2-3,6-13,16,23H,14-15,17H2,1H3 |
| InChIKey | PTCSYJUJIJDQEQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|