C17H15ClFNO3S — CID 90575062
N-[4-(2-chlorophenoxy)but-2-ynyl]-1-(3-fluorophenyl)methanesulfonamide (PubChem CID 90575062) has the molecular formula C17H15ClFNO3S and a molecular weight of 367.83 g/mol. Its IUPAC name is N-[4-(2-chlorophenoxy)but-2-ynyl]-1-(3-fluorophenyl)methanesulfonamide.
| Compound Name | N-[4-(2-chlorophenoxy)but-2-ynyl]-1-(3-fluorophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 90575062 |
| Molecular Formula | C17H15ClFNO3S |
| Molecular Weight | 367.83 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | N-[4-(2-chlorophenoxy)but-2-ynyl]-1-(3-fluorophenyl)methanesulfonamide |
| SMILES | O=S(=O)(Cc1cccc(F)c1)NCC#CCOc1ccccc1Cl |
| InChI | InChI=1S/C17H15ClFNO3S/c18-16-8-1-2-9-17(16)23-11-4-3-10-20-24(21,22)13-14-6-5-7-15(19)12-14/h1-2,5-9,12,20H,10-11,13H2 |
| InChIKey | YMVGUJFAOWUGGQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.83 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|