C18H16F2N2O4S — CID 90580670
2-[4-[(2,5-difluorophenyl)methylsulfonylamino]but-2-ynoxy]benzamide (PubChem CID 90580670) has the molecular formula C18H16F2N2O4S and a molecular weight of 394.40 g/mol. Its IUPAC name is 2-[4-[(2,5-difluorophenyl)methylsulfonylamino]but-2-ynoxy]benzamide.
| Compound Name | 2-[4-[(2,5-difluorophenyl)methylsulfonylamino]but-2-ynoxy]benzamide |
|---|---|
| PubChem CID | 90580670 |
| Molecular Formula | C18H16F2N2O4S |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 2-[4-[(2,5-difluorophenyl)methylsulfonylamino]but-2-ynoxy]benzamide |
| SMILES | NC(=O)c1ccccc1OCC#CCNS(=O)(=O)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C18H16F2N2O4S/c19-14-7-8-16(20)13(11-14)12-27(24,25)22-9-3-4-10-26-17-6-2-1-5-15(17)18(21)23/h1-2,5-8,11,22H,9-10,12H2,(H2,21,23) |
| InChIKey | ZURQUMHIVSPYEM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|