C17H14ClF2NO3S — CID 90577965
1-(4-chlorophenyl)-N-[4-(2,4-difluorophenoxy)but-2-ynyl]methanesulfonamide (PubChem CID 90577965) has the molecular formula C17H14ClF2NO3S and a molecular weight of 385.82 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[4-(2,4-difluorophenoxy)but-2-ynyl]methanesulfonamide.
| Compound Name | 1-(4-chlorophenyl)-N-[4-(2,4-difluorophenoxy)but-2-ynyl]methanesulfonamide |
|---|---|
| PubChem CID | 90577965 |
| Molecular Formula | C17H14ClF2NO3S |
| Molecular Weight | 385.82 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[4-(2,4-difluorophenoxy)but-2-ynyl]methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccc(Cl)cc1)NCC#CCOc1ccc(F)cc1F |
| InChI | InChI=1S/C17H14ClF2NO3S/c18-14-5-3-13(4-6-14)12-25(22,23)21-9-1-2-10-24-17-8-7-15(19)11-16(17)20/h3-8,11,21H,9-10,12H2 |
| InChIKey | HDKVGRXUDVELJB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.82 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|