C18H15F2NO5S — CID 90577962
methyl 4-[4-(2,4-difluorophenoxy)but-2-ynylsulfamoyl]benzoate (PubChem CID 90577962) has the molecular formula C18H15F2NO5S and a molecular weight of 395.38 g/mol. Its IUPAC name is methyl 4-[4-(2,4-difluorophenoxy)but-2-ynylsulfamoyl]benzoate.
| Compound Name | methyl 4-[4-(2,4-difluorophenoxy)but-2-ynylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 90577962 |
| Molecular Formula | C18H15F2NO5S |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | methyl 4-[4-(2,4-difluorophenoxy)but-2-ynylsulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NCC#CCOc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C18H15F2NO5S/c1-25-18(22)13-4-7-15(8-5-13)27(23,24)21-10-2-3-11-26-17-9-6-14(19)12-16(17)20/h4-9,12,21H,10-11H2,1H3 |
| InChIKey | LPNOYJNBTNENLB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|