C11H11F2NO3S — CID 90577892
N-[4-(2,4-difluorophenoxy)but-2-ynyl]methanesulfonamide (PubChem CID 90577892) has the molecular formula C11H11F2NO3S and a molecular weight of 275.28 g/mol. Its IUPAC name is N-[4-(2,4-difluorophenoxy)but-2-ynyl]methanesulfonamide.
| Compound Name | N-[4-(2,4-difluorophenoxy)but-2-ynyl]methanesulfonamide |
|---|---|
| PubChem CID | 90577892 |
| Molecular Formula | C11H11F2NO3S |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | N-[4-(2,4-difluorophenoxy)but-2-ynyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCC#CCOc1ccc(F)cc1F |
| InChI | InChI=1S/C11H11F2NO3S/c1-18(15,16)14-6-2-3-7-17-11-5-4-9(12)8-10(11)13/h4-5,8,14H,6-7H2,1H3 |
| InChIKey | KVHHMQVYCVGQOS-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|