C19H17F2NO2 — CID 90577659
N-[4-(2,4-difluorophenoxy)but-2-ynyl]-3,5-dimethylbenzamide (PubChem CID 90577659) has the molecular formula C19H17F2NO2 and a molecular weight of 329.35 g/mol. Its IUPAC name is N-[4-(2,4-difluorophenoxy)but-2-ynyl]-3,5-dimethylbenzamide.
| Compound Name | N-[4-(2,4-difluorophenoxy)but-2-ynyl]-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 90577659 |
| Molecular Formula | C19H17F2NO2 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | N-[4-(2,4-difluorophenoxy)but-2-ynyl]-3,5-dimethylbenzamide |
| SMILES | Cc1cc(C)cc(C(=O)NCC#CCOc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C19H17F2NO2/c1-13-9-14(2)11-15(10-13)19(23)22-7-3-4-8-24-18-6-5-16(20)12-17(18)21/h5-6,9-12H,7-8H2,1-2H3,(H,22,23) |
| InChIKey | KCXCPXFFIVGGDZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|