C24H19F2NO2 — CID 90577778
N-[4-(2,4-difluorophenoxy)but-2-ynyl]-2-(4-phenylphenyl)acetamide (PubChem CID 90577778) has the molecular formula C24H19F2NO2 and a molecular weight of 391.42 g/mol. Its IUPAC name is N-[4-(2,4-difluorophenoxy)but-2-ynyl]-2-(4-phenylphenyl)acetamide.
| Compound Name | N-[4-(2,4-difluorophenoxy)but-2-ynyl]-2-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 90577778 |
| Molecular Formula | C24H19F2NO2 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | N-[4-(2,4-difluorophenoxy)but-2-ynyl]-2-(4-phenylphenyl)acetamide |
| SMILES | O=C(Cc1ccc(-c2ccccc2)cc1)NCC#CCOc1ccc(F)cc1F |
| InChI | InChI=1S/C24H19F2NO2/c25-21-12-13-23(22(26)17-21)29-15-5-4-14-27-24(28)16-18-8-10-20(11-9-18)19-6-2-1-3-7-19/h1-3,6-13,17H,14-16H2,(H,27,28) |
| InChIKey | DMVMZCIZAXVRFW-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|