C17H19F2NO2S — CID 90577572
2-cyclopentylsulfanyl-N-[4-(2,4-difluorophenoxy)but-2-ynyl]acetamide (PubChem CID 90577572) has the molecular formula C17H19F2NO2S and a molecular weight of 339.41 g/mol. Its IUPAC name is 2-cyclopentylsulfanyl-N-[4-(2,4-difluorophenoxy)but-2-ynyl]acetamide.
| Compound Name | 2-cyclopentylsulfanyl-N-[4-(2,4-difluorophenoxy)but-2-ynyl]acetamide |
|---|---|
| PubChem CID | 90577572 |
| Molecular Formula | C17H19F2NO2S |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 2-cyclopentylsulfanyl-N-[4-(2,4-difluorophenoxy)but-2-ynyl]acetamide |
| SMILES | O=C(CSC1CCCC1)NCC#CCOc1ccc(F)cc1F |
| InChI | InChI=1S/C17H19F2NO2S/c18-13-7-8-16(15(19)11-13)22-10-4-3-9-20-17(21)12-23-14-5-1-2-6-14/h7-8,11,14H,1-2,5-6,9-10,12H2,(H,20,21) |
| InChIKey | GLTBHULJGRHFFZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|