C14H13F2N5O2S — CID 90577590
N-[4-(2,4-difluorophenoxy)but-2-ynyl]-2-(1-methyltetrazol-5-yl)sulfanylacetamide (PubChem CID 90577590) has the molecular formula C14H13F2N5O2S and a molecular weight of 353.35 g/mol. Its IUPAC name is N-[4-(2,4-difluorophenoxy)but-2-ynyl]-2-(1-methyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-[4-(2,4-difluorophenoxy)but-2-ynyl]-2-(1-methyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 90577590 |
| Molecular Formula | C14H13F2N5O2S |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | N-[4-(2,4-difluorophenoxy)but-2-ynyl]-2-(1-methyltetrazol-5-yl)sulfanylacetamide |
| SMILES | Cn1nnnc1SCC(=O)NCC#CCOc1ccc(F)cc1F |
| InChI | InChI=1S/C14H13F2N5O2S/c1-21-14(18-19-20-21)24-9-13(22)17-6-2-3-7-23-12-5-4-10(15)8-11(12)16/h4-5,8H,6-7,9H2,1H3,(H,17,22) |
| InChIKey | RHHYWKHONUUSTP-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|