C15H17N5O2S — CID 90575103
N-[4-(2-methylphenoxy)but-2-ynyl]-2-(1-methyltetrazol-5-yl)sulfanylacetamide (PubChem CID 90575103) has the molecular formula C15H17N5O2S and a molecular weight of 331.40 g/mol. Its IUPAC name is N-[4-(2-methylphenoxy)but-2-ynyl]-2-(1-methyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-[4-(2-methylphenoxy)but-2-ynyl]-2-(1-methyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 90575103 |
| Molecular Formula | C15H17N5O2S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | N-[4-(2-methylphenoxy)but-2-ynyl]-2-(1-methyltetrazol-5-yl)sulfanylacetamide |
| SMILES | Cc1ccccc1OCC#CCNC(=O)CSc1nnnn1C |
| InChI | InChI=1S/C15H17N5O2S/c1-12-7-3-4-8-13(12)22-10-6-5-9-16-14(21)11-23-15-17-18-19-20(15)2/h3-4,7-8H,9-11H2,1-2H3,(H,16,21) |
| InChIKey | AKTXQORHLPVFMU-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|