C15H17F2NO2 — CID 90577630
N-[4-(2,4-difluorophenoxy)but-2-ynyl]pentanamide (PubChem CID 90577630) has the molecular formula C15H17F2NO2 and a molecular weight of 281.30 g/mol. Its IUPAC name is N-[4-(2,4-difluorophenoxy)but-2-ynyl]pentanamide.
| Compound Name | N-[4-(2,4-difluorophenoxy)but-2-ynyl]pentanamide |
|---|---|
| PubChem CID | 90577630 |
| Molecular Formula | C15H17F2NO2 |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | N-[4-(2,4-difluorophenoxy)but-2-ynyl]pentanamide |
| SMILES | CCCCC(=O)NCC#CCOc1ccc(F)cc1F |
| InChI | InChI=1S/C15H17F2NO2/c1-2-3-6-15(19)18-9-4-5-10-20-14-8-7-12(16)11-13(14)17/h7-8,11H,2-3,6,9-10H2,1H3,(H,18,19) |
| InChIKey | KXCMGDNKWMMGMD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|