C21H21F2NO4S — CID 90577812
N-[4-(2,4-difluorophenoxy)but-2-ynyl]-2-(4-propan-2-ylsulfonylphenyl)acetamide (PubChem CID 90577812) has the molecular formula C21H21F2NO4S and a molecular weight of 421.47 g/mol. Its IUPAC name is N-[4-(2,4-difluorophenoxy)but-2-ynyl]-2-(4-propan-2-ylsulfonylphenyl)acetamide.
| Compound Name | N-[4-(2,4-difluorophenoxy)but-2-ynyl]-2-(4-propan-2-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 90577812 |
| Molecular Formula | C21H21F2NO4S |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | N-[4-(2,4-difluorophenoxy)but-2-ynyl]-2-(4-propan-2-ylsulfonylphenyl)acetamide |
| SMILES | CC(C)S(=O)(=O)c1ccc(CC(=O)NCC#CCOc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C21H21F2NO4S/c1-15(2)29(26,27)18-8-5-16(6-9-18)13-21(25)24-11-3-4-12-28-20-10-7-17(22)14-19(20)23/h5-10,14-15H,11-13H2,1-2H3,(H,24,25) |
| InChIKey | LVUJMQCWZBJNNX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|