C13H12ClF2NO2 — CID 90577651
3-chloro-N-[4-(2,4-difluorophenoxy)but-2-ynyl]propanamide (PubChem CID 90577651) has the molecular formula C13H12ClF2NO2 and a molecular weight of 287.69 g/mol. Its IUPAC name is 3-chloro-N-[4-(2,4-difluorophenoxy)but-2-ynyl]propanamide.
| Compound Name | 3-chloro-N-[4-(2,4-difluorophenoxy)but-2-ynyl]propanamide |
|---|---|
| PubChem CID | 90577651 |
| Molecular Formula | C13H12ClF2NO2 |
| Molecular Weight | 287.69 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 3-chloro-N-[4-(2,4-difluorophenoxy)but-2-ynyl]propanamide |
| SMILES | O=C(CCCl)NCC#CCOc1ccc(F)cc1F |
| InChI | InChI=1S/C13H12ClF2NO2/c14-6-5-13(18)17-7-1-2-8-19-12-4-3-10(15)9-11(12)16/h3-4,9H,5-8H2,(H,17,18) |
| InChIKey | PVTUCRVDXKCJCW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.69 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|