C19H23F2NO2 — CID 90577641
3-cyclohexyl-N-[4-(2,4-difluorophenoxy)but-2-ynyl]propanamide (PubChem CID 90577641) has the molecular formula C19H23F2NO2 and a molecular weight of 335.39 g/mol. Its IUPAC name is 3-cyclohexyl-N-[4-(2,4-difluorophenoxy)but-2-ynyl]propanamide.
| Compound Name | 3-cyclohexyl-N-[4-(2,4-difluorophenoxy)but-2-ynyl]propanamide |
|---|---|
| PubChem CID | 90577641 |
| Molecular Formula | C19H23F2NO2 |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 3-cyclohexyl-N-[4-(2,4-difluorophenoxy)but-2-ynyl]propanamide |
| SMILES | O=C(CCC1CCCCC1)NCC#CCOc1ccc(F)cc1F |
| InChI | InChI=1S/C19H23F2NO2/c20-16-9-10-18(17(21)14-16)24-13-5-4-12-22-19(23)11-8-15-6-2-1-3-7-15/h9-10,14-15H,1-3,6-8,11-13H2,(H,22,23) |
| InChIKey | YBRGXHXAQMBMSM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|