C18H20F2N2O3 — CID 90577622
1-acetyl-N-[4-(2,4-difluorophenoxy)but-2-ynyl]piperidine-4-carboxamide (PubChem CID 90577622) has the molecular formula C18H20F2N2O3 and a molecular weight of 350.37 g/mol. Its IUPAC name is 1-acetyl-N-[4-(2,4-difluorophenoxy)but-2-ynyl]piperidine-4-carboxamide.
| Compound Name | 1-acetyl-N-[4-(2,4-difluorophenoxy)but-2-ynyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 90577622 |
| Molecular Formula | C18H20F2N2O3 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 1-acetyl-N-[4-(2,4-difluorophenoxy)but-2-ynyl]piperidine-4-carboxamide |
| SMILES | CC(=O)N1CCC(C(=O)NCC#CCOc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C18H20F2N2O3/c1-13(23)22-9-6-14(7-10-22)18(24)21-8-2-3-11-25-17-5-4-15(19)12-16(17)20/h4-5,12,14H,6-11H2,1H3,(H,21,24) |
| InChIKey | MKSXCFKUNMILLW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|