C16H12F3NO3S — CID 90577897
N-[4-(2,4-difluorophenoxy)but-2-ynyl]-4-fluorobenzenesulfonamide (PubChem CID 90577897) has the molecular formula C16H12F3NO3S and a molecular weight of 355.34 g/mol. Its IUPAC name is N-[4-(2,4-difluorophenoxy)but-2-ynyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[4-(2,4-difluorophenoxy)but-2-ynyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 90577897 |
| Molecular Formula | C16H12F3NO3S |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | N-[4-(2,4-difluorophenoxy)but-2-ynyl]-4-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCC#CCOc1ccc(F)cc1F)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H12F3NO3S/c17-12-3-6-14(7-4-12)24(21,22)20-9-1-2-10-23-16-8-5-13(18)11-15(16)19/h3-8,11,20H,9-10H2 |
| InChIKey | LRZVOUPGGWLSEK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|