C16H13F2N3O3 — CID 90577594
N-[4-(2,4-difluorophenoxy)but-2-ynyl]-1-methyl-6-oxopyridazine-3-carboxamide (PubChem CID 90577594) has the molecular formula C16H13F2N3O3 and a molecular weight of 333.29 g/mol. Its IUPAC name is N-[4-(2,4-difluorophenoxy)but-2-ynyl]-1-methyl-6-oxopyridazine-3-carboxamide.
| Compound Name | N-[4-(2,4-difluorophenoxy)but-2-ynyl]-1-methyl-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 90577594 |
| Molecular Formula | C16H13F2N3O3 |
| Molecular Weight | 333.29 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | N-[4-(2,4-difluorophenoxy)but-2-ynyl]-1-methyl-6-oxopyridazine-3-carboxamide |
| SMILES | Cn1nc(C(=O)NCC#CCOc2ccc(F)cc2F)ccc1=O |
| InChI | InChI=1S/C16H13F2N3O3/c1-21-15(22)7-5-13(20-21)16(23)19-8-2-3-9-24-14-6-4-11(17)10-12(14)18/h4-7,10H,8-9H2,1H3,(H,19,23) |
| InChIKey | JXDVJKHDFLPJNJ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.29 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|