C14H14FN3O3 — CID 37361215
N-[2-(4-fluorophenoxy)ethyl]-1-methyl-6-oxopyridazine-3-carboxamide (PubChem CID 37361215) has the molecular formula C14H14FN3O3 and a molecular weight of 291.28 g/mol. Its IUPAC name is N-[2-(4-fluorophenoxy)ethyl]-1-methyl-6-oxopyridazine-3-carboxamide.
| Compound Name | N-[2-(4-fluorophenoxy)ethyl]-1-methyl-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 37361215 |
| Molecular Formula | C14H14FN3O3 |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | N-[2-(4-fluorophenoxy)ethyl]-1-methyl-6-oxopyridazine-3-carboxamide |
| SMILES | Cn1nc(C(=O)NCCOc2ccc(F)cc2)ccc1=O |
| InChI | InChI=1S/C14H14FN3O3/c1-18-13(19)7-6-12(17-18)14(20)16-8-9-21-11-4-2-10(15)3-5-11/h2-7H,8-9H2,1H3,(H,16,20) |
| InChIKey | CYLSYHZPKSNSSS-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|