C15H11F2N3O3 — CID 90577595
N-[4-(2,4-difluorophenoxy)but-2-ynyl]-6-oxo-1H-pyridazine-3-carboxamide (PubChem CID 90577595) has the molecular formula C15H11F2N3O3 and a molecular weight of 319.27 g/mol. Its IUPAC name is N-[4-(2,4-difluorophenoxy)but-2-ynyl]-6-oxo-1H-pyridazine-3-carboxamide.
| Compound Name | N-[4-(2,4-difluorophenoxy)but-2-ynyl]-6-oxo-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 90577595 |
| Molecular Formula | C15H11F2N3O3 |
| Molecular Weight | 319.27 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | N-[4-(2,4-difluorophenoxy)but-2-ynyl]-6-oxo-1H-pyridazine-3-carboxamide |
| SMILES | O=C(NCC#CCOc1ccc(F)cc1F)c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C15H11F2N3O3/c16-10-3-5-13(11(17)9-10)23-8-2-1-7-18-15(22)12-4-6-14(21)20-19-12/h3-6,9H,7-8H2,(H,18,22)(H,20,21) |
| InChIKey | SOIVALBTJMXATR-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.27 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|