C16H12F2N2O3 — CID 90577578
N-[4-(2,4-difluorophenoxy)but-2-ynyl]-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 90577578) has the molecular formula C16H12F2N2O3 and a molecular weight of 318.28 g/mol. Its IUPAC name is N-[4-(2,4-difluorophenoxy)but-2-ynyl]-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[4-(2,4-difluorophenoxy)but-2-ynyl]-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 90577578 |
| Molecular Formula | C16H12F2N2O3 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | N-[4-(2,4-difluorophenoxy)but-2-ynyl]-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | O=C(NCC#CCOc1ccc(F)cc1F)c1ccc[nH]c1=O |
| InChI | InChI=1S/C16H12F2N2O3/c17-11-5-6-14(13(18)10-11)23-9-2-1-7-19-15(21)12-4-3-8-20-16(12)22/h3-6,8,10H,7,9H2,(H,19,21)(H,20,22) |
| InChIKey | BTICBCTYRZQAOA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|